C21H21ClN2O4S2 — CID 87747821
(2-chlorophenyl) benzenesulfonate;2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetamide (PubChem CID 87747821) has the molecular formula C21H21ClN2O4S2 and a molecular weight of 465.00 g/mol. Its IUPAC name is (2-chlorophenyl) benzenesulfonate;2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetamide.
| Compound Name | (2-chlorophenyl) benzenesulfonate;2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetamide |
|---|---|
| PubChem CID | 87747821 |
| Molecular Formula | C21H21ClN2O4S2 |
| Molecular Weight | 465.00 g/mol |
| Exact Mass | 464.06 |
| IUPAC Name | (2-chlorophenyl) benzenesulfonate;2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetamide |
| SMILES | NC(=O)CN1CCc2sccc2C1.O=S(=O)(Oc1ccccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C12H9ClO3S.C9H12N2OS/c13-11-8-4-5-9-12(11)16-17(14,15)10-6-2-1-3-7-10;10-9(12)6-11-3-1-8-7(5-11)2-4-13-8/h1-9H;2,4H,1,3,5-6H2,(H2,10,12) |
| InChIKey | ITPBZEFDJPUJKY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.00 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|