C36H31ClN6O6 — CID 87749176
2-chloro-1-(4-methyl-3-nitrophenyl)indole-3-carbaldehyde;1-(4-methyl-3-nitrophenyl)-2-piperazin-1-ylindole-3-carbaldehyde (PubChem CID 87749176) has the molecular formula C36H31ClN6O6 and a molecular weight of 679.13 g/mol. Its IUPAC name is 2-chloro-1-(4-methyl-3-nitrophenyl)indole-3-carbaldehyde;1-(4-methyl-3-nitrophenyl)-2-piperazin-1-ylindole-3-carbaldehyde.
| Compound Name | 2-chloro-1-(4-methyl-3-nitrophenyl)indole-3-carbaldehyde;1-(4-methyl-3-nitrophenyl)-2-piperazin-1-ylindole-3-carbaldehyde |
|---|---|
| PubChem CID | 87749176 |
| Molecular Formula | C36H31ClN6O6 |
| Molecular Weight | 679.13 g/mol |
| Exact Mass | 678.20 |
| IUPAC Name | 2-chloro-1-(4-methyl-3-nitrophenyl)indole-3-carbaldehyde;1-(4-methyl-3-nitrophenyl)-2-piperazin-1-ylindole-3-carbaldehyde |
| SMILES | Cc1ccc(-n2c(Cl)c(C=O)c3ccccc32)cc1[N+](=O)[O-].Cc1ccc(-n2c(N3CCNCC3)c(C=O)c3ccccc32)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H20N4O3.C16H11ClN2O3/c1-14-6-7-15(12-19(14)24(26)27)23-18-5-3-2-4-16(18)17(13-25)20(23)22-10-8-21-9-11-22;1-10-6-7-11(8-15(10)19(21)22)18-14-5-3-2-4-12(14)13(9-20)16(18)17/h2-7,12-13,21H,8-11H2,1H3;2-9H,1H3 |
| InChIKey | GKCCVHQBSYQMRU-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 145.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.13 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|