C23H28ClN3O — CID 86596814
1-(4-butylphenyl)-2-piperazin-1-ylindole-3-carbaldehyde;hydrochloride (PubChem CID 86596814) has the molecular formula C23H28ClN3O and a molecular weight of 397.95 g/mol. Its IUPAC name is 1-(4-butylphenyl)-2-piperazin-1-ylindole-3-carbaldehyde;hydrochloride.
| Compound Name | 1-(4-butylphenyl)-2-piperazin-1-ylindole-3-carbaldehyde;hydrochloride |
|---|---|
| PubChem CID | 86596814 |
| Molecular Formula | C23H28ClN3O |
| Molecular Weight | 397.95 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 1-(4-butylphenyl)-2-piperazin-1-ylindole-3-carbaldehyde;hydrochloride |
| SMILES | CCCCc1ccc(-n2c(N3CCNCC3)c(C=O)c3ccccc32)cc1.Cl |
| InChI | InChI=1S/C23H27N3O.ClH/c1-2-3-6-18-9-11-19(12-10-18)26-22-8-5-4-7-20(22)21(17-27)23(26)25-15-13-24-14-16-25;/h4-5,7-12,17,24H,2-3,6,13-16H2,1H3;1H |
| InChIKey | DXOVMFAJBGGUTH-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.95 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|