C37H52N6O9S — CID 87751602
N-[(2S)-4-methyl-2-[[5-[2-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]ethoxy]-1-benzofuran-2-carbonyl]amino]pentanoyl]-N-pyridin-2-ylsulfonylazepan-4-amine oxide (PubChem CID 87751602) has the molecular formula C37H52N6O9S and a molecular weight of 756.92 g/mol. Its IUPAC name is N-[(2S)-4-methyl-2-[[5-[2-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]ethoxy]-1-benzofuran-2-carbonyl]amino]pentanoyl]-N-pyridin-2-ylsulfonylazepan-4-amine oxide.
| Compound Name | N-[(2S)-4-methyl-2-[[5-[2-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]ethoxy]-1-benzofuran-2-carbonyl]amino]pentanoyl]-N-pyridin-2-ylsulfonylazepan-4-amine oxide |
|---|---|
| PubChem CID | 87751602 |
| Molecular Formula | C37H52N6O9S |
| Molecular Weight | 756.92 g/mol |
| Exact Mass | 756.35 |
| IUPAC Name | N-[(2S)-4-methyl-2-[[5-[2-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]ethoxy]-1-benzofuran-2-carbonyl]amino]pentanoyl]-N-pyridin-2-ylsulfonylazepan-4-amine oxide |
| SMILES | CC(C)C[C@H](NC(=O)c1cc2cc(OCCN3CCN(C(=O)OC(C)(C)C)CC3)ccc2o1)C(=O)[N+]([O-])(C1CCCNCC1)S(=O)(=O)c1ccccn1 |
| InChI | InChI=1S/C37H52N6O9S/c1-26(2)23-30(35(45)43(47,28-9-8-14-38-16-13-28)53(48,49)33-10-6-7-15-39-33)40-34(44)32-25-27-24-29(11-12-31(27)51-32)50-22-21-41-17-19-42(20-18-41)36(46)52-37(3,4)5/h6-7,10-12,15,24-26,28,30,38H,8-9,13-14,16-23H2,1-5H3,(H,40,44)/t28?,30-,43?/m0/s1 |
| InChIKey | HMOXHSWYBMJCQV-AXVUORSPSA-N |
| XLogP | 4.28 |
| TPSA | 183.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.92 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|