C8H9Cl2N — CID 87755086
N,1-dichloro-2-phenylethanamine (PubChem CID 87755086) has the molecular formula C8H9Cl2N and a molecular weight of 190.07 g/mol. Its IUPAC name is N,1-dichloro-2-phenylethanamine.
| Compound Name | N,1-dichloro-2-phenylethanamine |
|---|---|
| PubChem CID | 87755086 |
| Molecular Formula | C8H9Cl2N |
| Molecular Weight | 190.07 g/mol |
| Exact Mass | 189.01 |
| IUPAC Name | N,1-dichloro-2-phenylethanamine |
| SMILES | ClNC(Cl)Cc1ccccc1 |
| InChI | InChI=1S/C8H9Cl2N/c9-8(11-10)6-7-4-2-1-3-5-7/h1-5,8,11H,6H2 |
| InChIKey | DCEJPVSHHAFZCN-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.07 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|