About chloro(1,3-diphenylpropan-2-yl)tin
chloro(1,3-diphenylpropan-2-yl)tin (PubChem CID 175601747) has the molecular formula C15H15ClSn
and a molecular weight of 349.45 g/mol. Its IUPAC name is chloro(1,3-diphenylpropan-2-yl)tin.
Molecular Properties
| Compound Name | chloro(1,3-diphenylpropan-2-yl)tin |
| PubChem CID | 175601747 |
| Molecular Formula | C15H15ClSn |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.99 |
| IUPAC Name | chloro(1,3-diphenylpropan-2-yl)tin |
| SMILES | Cl[Sn]C(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C15H15.ClH.Sn/c1-3-8-14(9-4-1)12-7-13-15-10-5-2-6-11-15;;/h1-11H,12-13H2;1H;/q;;+1/p-1 |
| InChIKey | LXEVSZFDXWJVPT-UHFFFAOYSA-M |
| XLogP | 4.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze chloro(1,3-diphenylpropan-2-yl)tin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro(1,3-diphenylpropan-2-yl)tin?
The IUPAC name of chloro(1,3-diphenylpropan-2-yl)tin (CID 175601747) is chloro(1,3-diphenylpropan-2-yl)tin.
What is the SMILES notation for chloro(1,3-diphenylpropan-2-yl)tin?
The canonical SMILES for chloro(1,3-diphenylpropan-2-yl)tin is Cl[Sn]C(Cc1ccccc1)Cc1ccccc1.
What is the InChIKey of chloro(1,3-diphenylpropan-2-yl)tin?
The InChIKey is LXEVSZFDXWJVPT-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H15.ClH.Sn/c1-3-8-14(9-4-1)12-7-13-15-10-5-2-6-11-15;;/h1-11H,12-13H2;1H;/q;;+1/p-1.
What are the key properties of chloro(1,3-diphenylpropan-2-yl)tin?
chloro(1,3-diphenylpropan-2-yl)tin has a molecular weight of 349.45 g/mol, XLogP of 4.12, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chloro(1,3-diphenylpropan-2-yl)tin is sourced from PubChem (CID 175601747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).