About 4-aminobutoxycarbamic acid
4-aminobutoxycarbamic acid (PubChem CID 87755942) has the molecular formula C5H12N2O3
and a molecular weight of 148.16 g/mol. Its IUPAC name is 4-aminobutoxycarbamic acid.
Molecular Properties
| Compound Name | 4-aminobutoxycarbamic acid |
| PubChem CID | 87755942 |
| Molecular Formula | C5H12N2O3 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.08 |
| IUPAC Name | 4-aminobutoxycarbamic acid |
| SMILES | NCCCCONC(=O)O |
| InChI | InChI=1S/C5H12N2O3/c6-3-1-2-4-10-7-5(8)9/h7H,1-4,6H2,(H,8,9) |
| InChIKey | NJAUCONHBKLBML-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-aminobutoxycarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminobutoxycarbamic acid?
The IUPAC name of 4-aminobutoxycarbamic acid (CID 87755942) is 4-aminobutoxycarbamic acid.
What is the SMILES notation for 4-aminobutoxycarbamic acid?
The canonical SMILES for 4-aminobutoxycarbamic acid is NCCCCONC(=O)O.
What is the InChIKey of 4-aminobutoxycarbamic acid?
The InChIKey is NJAUCONHBKLBML-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2O3/c6-3-1-2-4-10-7-5(8)9/h7H,1-4,6H2,(H,8,9).
What are the key properties of 4-aminobutoxycarbamic acid?
4-aminobutoxycarbamic acid has a molecular weight of 148.16 g/mol, XLogP of -0.08, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminobutoxycarbamic acid is sourced from PubChem (CID 87755942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).