C7H13NO7 — CID 90201502
2-[2-[2-(carboxyamino)oxyethoxy]ethoxy]acetic acid (PubChem CID 90201502) has the molecular formula C7H13NO7 and a molecular weight of 223.18 g/mol. Its IUPAC name is 2-[2-[2-(carboxyamino)oxyethoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[2-(carboxyamino)oxyethoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 90201502 |
| Molecular Formula | C7H13NO7 |
| Molecular Weight | 223.18 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | 2-[2-[2-(carboxyamino)oxyethoxy]ethoxy]acetic acid |
| SMILES | O=C(O)COCCOCCONC(=O)O |
| InChI | InChI=1S/C7H13NO7/c9-6(10)5-14-2-1-13-3-4-15-8-7(11)12/h8H,1-5H2,(H,9,10)(H,11,12) |
| InChIKey | ICIGBIAQVDGRAO-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.18 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|