C11H21NO7 — CID 126620150
2-[2-[2-[2-(prop-1-en-2-yloxyamino)oxyethoxy]ethoxy]ethoxy]acetic acid (PubChem CID 126620150) has the molecular formula C11H21NO7 and a molecular weight of 279.29 g/mol. Its IUPAC name is 2-[2-[2-[2-(prop-1-en-2-yloxyamino)oxyethoxy]ethoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[2-[2-(prop-1-en-2-yloxyamino)oxyethoxy]ethoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 126620150 |
| Molecular Formula | C11H21NO7 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 2-[2-[2-[2-(prop-1-en-2-yloxyamino)oxyethoxy]ethoxy]ethoxy]acetic acid |
| SMILES | C=C(C)ONOCCOCCOCCOCC(=O)O |
| InChI | InChI=1S/C11H21NO7/c1-10(2)19-12-18-8-7-16-4-3-15-5-6-17-9-11(13)14/h12H,1,3-9H2,2H3,(H,13,14) |
| InChIKey | SJYMXUKLCACVNQ-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|