About bis(6-aminohexyl) carbonate
bis(6-aminohexyl) carbonate (PubChem CID 87932900) has the molecular formula C13H28N2O3
and a molecular weight of 260.38 g/mol. Its IUPAC name is bis(6-aminohexyl) carbonate.
Molecular Properties
| Compound Name | bis(6-aminohexyl) carbonate |
| PubChem CID | 87932900 |
| Molecular Formula | C13H28N2O3 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.21 |
| IUPAC Name | bis(6-aminohexyl) carbonate |
| SMILES | NCCCCCCOC(=O)OCCCCCCN |
| InChI | InChI=1S/C13H28N2O3/c14-9-5-1-3-7-11-17-13(16)18-12-8-4-2-6-10-15/h1-12,14-15H2 |
| InChIKey | ISJFYDAHBSUYQF-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bis(6-aminohexyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(6-aminohexyl) carbonate?
The IUPAC name of bis(6-aminohexyl) carbonate (CID 87932900) is bis(6-aminohexyl) carbonate.
What is the SMILES notation for bis(6-aminohexyl) carbonate?
The canonical SMILES for bis(6-aminohexyl) carbonate is NCCCCCCOC(=O)OCCCCCCN.
What is the InChIKey of bis(6-aminohexyl) carbonate?
The InChIKey is ISJFYDAHBSUYQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28N2O3/c14-9-5-1-3-7-11-17-13(16)18-12-8-4-2-6-10-15/h1-12,14-15H2.
What are the key properties of bis(6-aminohexyl) carbonate?
bis(6-aminohexyl) carbonate has a molecular weight of 260.38 g/mol, XLogP of 2.18, 12 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(6-aminohexyl) carbonate is sourced from PubChem (CID 87932900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).