C20H28ClN3O5S2 — CID 87757511
3-chloro-N-[4-(2-hydroxybutyl)-1,3-thiazol-2-yl]-4-(3-morpholin-4-ylpropoxy)benzenesulfonamide (PubChem CID 87757511) has the molecular formula C20H28ClN3O5S2 and a molecular weight of 490.05 g/mol. Its IUPAC name is 3-chloro-N-[4-(2-hydroxybutyl)-1,3-thiazol-2-yl]-4-(3-morpholin-4-ylpropoxy)benzenesulfonamide.
| Compound Name | 3-chloro-N-[4-(2-hydroxybutyl)-1,3-thiazol-2-yl]-4-(3-morpholin-4-ylpropoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 87757511 |
| Molecular Formula | C20H28ClN3O5S2 |
| Molecular Weight | 490.05 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | 3-chloro-N-[4-(2-hydroxybutyl)-1,3-thiazol-2-yl]-4-(3-morpholin-4-ylpropoxy)benzenesulfonamide |
| SMILES | CCC(O)Cc1csc(NS(=O)(=O)c2ccc(OCCCN3CCOCC3)c(Cl)c2)n1 |
| InChI | InChI=1S/C20H28ClN3O5S2/c1-2-16(25)12-15-14-30-20(22-15)23-31(26,27)17-4-5-19(18(21)13-17)29-9-3-6-24-7-10-28-11-8-24/h4-5,13-14,16,25H,2-3,6-12H2,1H3,(H,22,23) |
| InChIKey | MXRWCAHZXRTRRC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 100.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.05 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|