C11H16N4O9 — CID 87758902
4-[[(4-methoxy-4-oxobutanoyl)carbamoylamino]oxycarbamoylamino]-4-oxobutanoic acid (PubChem CID 87758902) has the molecular formula C11H16N4O9 and a molecular weight of 348.27 g/mol. Its IUPAC name is 4-[[(4-methoxy-4-oxobutanoyl)carbamoylamino]oxycarbamoylamino]-4-oxobutanoic acid.
| Compound Name | 4-[[(4-methoxy-4-oxobutanoyl)carbamoylamino]oxycarbamoylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 87758902 |
| Molecular Formula | C11H16N4O9 |
| Molecular Weight | 348.27 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 4-[[(4-methoxy-4-oxobutanoyl)carbamoylamino]oxycarbamoylamino]-4-oxobutanoic acid |
| SMILES | COC(=O)CCC(=O)NC(=O)NONC(=O)NC(=O)CCC(=O)O |
| InChI | InChI=1S/C11H16N4O9/c1-23-9(20)5-3-7(17)13-11(22)15-24-14-10(21)12-6(16)2-4-8(18)19/h2-5H2,1H3,(H,18,19)(H2,12,14,16,21)(H2,13,15,17,22) |
| InChIKey | YAWLUKPQADDWKI-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 189.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.27 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|