C31H50O30 — CID 173361871
hexakis(butanedioic acid);ethane-1,2-diol;4-methoxy-4-oxobutanoic acid (PubChem CID 173361871) has the molecular formula C31H50O30 and a molecular weight of 902.71 g/mol. Its IUPAC name is hexakis(butanedioic acid);ethane-1,2-diol;4-methoxy-4-oxobutanoic acid.
| Compound Name | hexakis(butanedioic acid);ethane-1,2-diol;4-methoxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 173361871 |
| Molecular Formula | C31H50O30 |
| Molecular Weight | 902.71 g/mol |
| Exact Mass | 902.24 |
| IUPAC Name | hexakis(butanedioic acid);ethane-1,2-diol;4-methoxy-4-oxobutanoic acid |
| SMILES | COC(=O)CCC(=O)O.O=C(O)CCC(=O)O.O=C(O)CCC(=O)O.O=C(O)CCC(=O)O.O=C(O)CCC(=O)O.O=C(O)CCC(=O)O.O=C(O)CCC(=O)O.OCCO |
| InChI | InChI=1S/C5H8O4.6C4H6O4.C2H6O2/c1-9-5(8)3-2-4(6)7;6*5-3(6)1-2-4(7)8;3-1-2-4/h2-3H2,1H3,(H,6,7);6*1-2H2,(H,5,6)(H,7,8);3-4H,1-2H2 |
| InChIKey | BUEFFVPELATAFB-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 551.66 Ų |
| H-Bond Donors | 15 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 902.71 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 15 |
| H-Bond Acceptors ≤ 10 | 17 |