C10H17O6P — CID 71420350
3-[2-carboxyethyl-(3-methoxy-3-oxopropyl)phosphanyl]propanoic acid (PubChem CID 71420350) has the molecular formula C10H17O6P and a molecular weight of 264.21 g/mol. Its IUPAC name is 3-[2-carboxyethyl-(3-methoxy-3-oxopropyl)phosphanyl]propanoic acid.
| Compound Name | 3-[2-carboxyethyl-(3-methoxy-3-oxopropyl)phosphanyl]propanoic acid |
|---|---|
| PubChem CID | 71420350 |
| Molecular Formula | C10H17O6P |
| Molecular Weight | 264.21 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 3-[2-carboxyethyl-(3-methoxy-3-oxopropyl)phosphanyl]propanoic acid |
| SMILES | COC(=O)CCP(CCC(=O)O)CCC(=O)O |
| InChI | InChI=1S/C10H17O6P/c1-16-10(15)4-7-17(5-2-8(11)12)6-3-9(13)14/h2-7H2,1H3,(H,11,12)(H,13,14) |
| InChIKey | SWVICPBDVHWCGL-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.21 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|