C9H16BrO6P — CID 172915831
3-[bis(2-carboxyethyl)phosphanyl]propanoic acid;hydrobromide (PubChem CID 172915831) has the molecular formula C9H16BrO6P and a molecular weight of 331.10 g/mol. Its IUPAC name is 3-[bis(2-carboxyethyl)phosphanyl]propanoic acid;hydrobromide.
| Compound Name | 3-[bis(2-carboxyethyl)phosphanyl]propanoic acid;hydrobromide |
|---|---|
| PubChem CID | 172915831 |
| Molecular Formula | C9H16BrO6P |
| Molecular Weight | 331.10 g/mol |
| Exact Mass | 329.99 |
| IUPAC Name | 3-[bis(2-carboxyethyl)phosphanyl]propanoic acid;hydrobromide |
| SMILES | Br.O=C(O)CCP(CCC(=O)O)CCC(=O)O |
| InChI | InChI=1S/C9H15O6P.BrH/c10-7(11)1-4-16(5-2-8(12)13)6-3-9(14)15;/h1-6H2,(H,10,11)(H,12,13)(H,14,15);1H |
| InChIKey | VEGVURIBOACHFD-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.10 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|