C9H18ClO7P — CID 87125828
3-[bis(2-carboxyethyl)phosphanyl]propanoic acid;hydrate;hydrochloride (PubChem CID 87125828) has the molecular formula C9H18ClO7P and a molecular weight of 304.66 g/mol. Its IUPAC name is 3-[bis(2-carboxyethyl)phosphanyl]propanoic acid;hydrate;hydrochloride.
| Compound Name | 3-[bis(2-carboxyethyl)phosphanyl]propanoic acid;hydrate;hydrochloride |
|---|---|
| PubChem CID | 87125828 |
| Molecular Formula | C9H18ClO7P |
| Molecular Weight | 304.66 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 3-[bis(2-carboxyethyl)phosphanyl]propanoic acid;hydrate;hydrochloride |
| SMILES | Cl.O.O=C(O)CCP(CCC(=O)O)CCC(=O)O |
| InChI | InChI=1S/C9H15O6P.ClH.H2O/c10-7(11)1-4-16(5-2-8(12)13)6-3-9(14)15;;/h1-6H2,(H,10,11)(H,12,13)(H,14,15);1H;1H2 |
| InChIKey | OYTDBQLWQBOPOK-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 143.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.66 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|