C12H22NO8PS — CID 121439681
2-amino-3-sulfanylpropanoic acid;3-[bis(2-carboxyethyl)phosphanyl]propanoic acid (PubChem CID 121439681) has the molecular formula C12H22NO8PS and a molecular weight of 371.35 g/mol. Its IUPAC name is 2-amino-3-sulfanylpropanoic acid;3-[bis(2-carboxyethyl)phosphanyl]propanoic acid.
| Compound Name | 2-amino-3-sulfanylpropanoic acid;3-[bis(2-carboxyethyl)phosphanyl]propanoic acid |
|---|---|
| PubChem CID | 121439681 |
| Molecular Formula | C12H22NO8PS |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | 2-amino-3-sulfanylpropanoic acid;3-[bis(2-carboxyethyl)phosphanyl]propanoic acid |
| SMILES | NC(CS)C(=O)O.O=C(O)CCP(CCC(=O)O)CCC(=O)O |
| InChI | InChI=1S/C9H15O6P.C3H7NO2S/c10-7(11)1-4-16(5-2-8(12)13)6-3-9(14)15;4-2(1-7)3(5)6/h1-6H2,(H,10,11)(H,12,13)(H,14,15);2,7H,1,4H2,(H,5,6) |
| InChIKey | SELNTIGHBHWFFA-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 175.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|