C11H19N2O8P — CID 177300512
3-[2-carboxyethyl-[3-[hydroxy-[2-(hydroxyamino)-2-oxoethyl]amino]-3-oxopropyl]phosphanyl]propanoic acid (PubChem CID 177300512) has the molecular formula C11H19N2O8P and a molecular weight of 338.25 g/mol. Its IUPAC name is 3-[2-carboxyethyl-[3-[hydroxy-[2-(hydroxyamino)-2-oxoethyl]amino]-3-oxopropyl]phosphanyl]propanoic acid.
| Compound Name | 3-[2-carboxyethyl-[3-[hydroxy-[2-(hydroxyamino)-2-oxoethyl]amino]-3-oxopropyl]phosphanyl]propanoic acid |
|---|---|
| PubChem CID | 177300512 |
| Molecular Formula | C11H19N2O8P |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 3-[2-carboxyethyl-[3-[hydroxy-[2-(hydroxyamino)-2-oxoethyl]amino]-3-oxopropyl]phosphanyl]propanoic acid |
| SMILES | O=C(O)CCP(CCC(=O)O)CCC(=O)N(O)CC(=O)NO |
| InChI | InChI=1S/C11H19N2O8P/c14-8(12-20)7-13(21)9(15)1-4-22(5-2-10(16)17)6-3-11(18)19/h20-21H,1-7H2,(H,12,14)(H,16,17)(H,18,19) |
| InChIKey | RPBOAKRGIGDTJA-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 164.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|