C12H20NO8P — CID 177300528
3-[2-carboxyethyl-[3-[hydroxy-(2-methoxy-2-oxoethyl)amino]-3-oxopropyl]phosphanyl]propanoic acid (PubChem CID 177300528) has the molecular formula C12H20NO8P and a molecular weight of 337.27 g/mol. Its IUPAC name is 3-[2-carboxyethyl-[3-[hydroxy-(2-methoxy-2-oxoethyl)amino]-3-oxopropyl]phosphanyl]propanoic acid.
| Compound Name | 3-[2-carboxyethyl-[3-[hydroxy-(2-methoxy-2-oxoethyl)amino]-3-oxopropyl]phosphanyl]propanoic acid |
|---|---|
| PubChem CID | 177300528 |
| Molecular Formula | C12H20NO8P |
| Molecular Weight | 337.27 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 3-[2-carboxyethyl-[3-[hydroxy-(2-methoxy-2-oxoethyl)amino]-3-oxopropyl]phosphanyl]propanoic acid |
| SMILES | COC(=O)CN(O)C(=O)CCP(CCC(=O)O)CCC(=O)O |
| InChI | InChI=1S/C12H20NO8P/c1-21-12(19)8-13(20)9(14)2-5-22(6-3-10(15)16)7-4-11(17)18/h20H,2-8H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | KXUITLDDRHTPJX-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 141.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.27 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|