C17H29O9P — CID 91357711
3-[bis(2-carboxyethyl)phosphanyl]propanoic acid;tert-butyl 3-oxobutanoate (PubChem CID 91357711) has the molecular formula C17H29O9P and a molecular weight of 408.38 g/mol. Its IUPAC name is 3-[bis(2-carboxyethyl)phosphanyl]propanoic acid;tert-butyl 3-oxobutanoate.
| Compound Name | 3-[bis(2-carboxyethyl)phosphanyl]propanoic acid;tert-butyl 3-oxobutanoate |
|---|---|
| PubChem CID | 91357711 |
| Molecular Formula | C17H29O9P |
| Molecular Weight | 408.38 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 3-[bis(2-carboxyethyl)phosphanyl]propanoic acid;tert-butyl 3-oxobutanoate |
| SMILES | CC(=O)CC(=O)OC(C)(C)C.O=C(O)CCP(CCC(=O)O)CCC(=O)O |
| InChI | InChI=1S/C9H15O6P.C8H14O3/c10-7(11)1-4-16(5-2-8(12)13)6-3-9(14)15;1-6(9)5-7(10)11-8(2,3)4/h1-6H2,(H,10,11)(H,12,13)(H,14,15);5H2,1-4H3 |
| InChIKey | BVJRFUVKHWUVBO-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 155.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|