C19H14Cl2FN3O — CID 87758912
6-chloro-N-[4-chloro-3-(4-fluoroanilino)phenyl]-2-methylpyridine-3-carboxamide (PubChem CID 87758912) has the molecular formula C19H14Cl2FN3O and a molecular weight of 390.25 g/mol. Its IUPAC name is 6-chloro-N-[4-chloro-3-(4-fluoroanilino)phenyl]-2-methylpyridine-3-carboxamide.
| Compound Name | 6-chloro-N-[4-chloro-3-(4-fluoroanilino)phenyl]-2-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 87758912 |
| Molecular Formula | C19H14Cl2FN3O |
| Molecular Weight | 390.25 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | 6-chloro-N-[4-chloro-3-(4-fluoroanilino)phenyl]-2-methylpyridine-3-carboxamide |
| SMILES | Cc1nc(Cl)ccc1C(=O)Nc1ccc(Cl)c(Nc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C19H14Cl2FN3O/c1-11-15(7-9-18(21)23-11)19(26)25-14-6-8-16(20)17(10-14)24-13-4-2-12(22)3-5-13/h2-10,24H,1H3,(H,25,26) |
| InChIKey | IUAMEVCZHACXDJ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.25 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|