C17H26N2O2S — CID 8775896
(5-acetyl-2-ethoxyphenyl)methyl N'-(3-methylbutyl)carbamimidothioate (PubChem CID 8775896) has the molecular formula C17H26N2O2S and a molecular weight of 322.47 g/mol. Its IUPAC name is (5-acetyl-2-ethoxyphenyl)methyl N'-(3-methylbutyl)carbamimidothioate.
| Compound Name | (5-acetyl-2-ethoxyphenyl)methyl N'-(3-methylbutyl)carbamimidothioate |
|---|---|
| PubChem CID | 8775896 |
| Molecular Formula | C17H26N2O2S |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | (5-acetyl-2-ethoxyphenyl)methyl N'-(3-methylbutyl)carbamimidothioate |
| SMILES | CCOc1ccc(C(C)=O)cc1CS/C(N)=N/CCC(C)C |
| InChI | InChI=1S/C17H26N2O2S/c1-5-21-16-7-6-14(13(4)20)10-15(16)11-22-17(18)19-9-8-12(2)3/h6-7,10,12H,5,8-9,11H2,1-4H3,(H2,18,19) |
| InChIKey | ZKDUGVDJNUUIIT-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|