C10H17NO6P2 — CID 87763045
[2-(4-aminophenyl)-1-dimethoxyphosphorylethyl]phosphonic acid (PubChem CID 87763045) has the molecular formula C10H17NO6P2 and a molecular weight of 309.20 g/mol. Its IUPAC name is [2-(4-aminophenyl)-1-dimethoxyphosphorylethyl]phosphonic acid.
| Compound Name | [2-(4-aminophenyl)-1-dimethoxyphosphorylethyl]phosphonic acid |
|---|---|
| PubChem CID | 87763045 |
| Molecular Formula | C10H17NO6P2 |
| Molecular Weight | 309.20 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | [2-(4-aminophenyl)-1-dimethoxyphosphorylethyl]phosphonic acid |
| SMILES | COP(=O)(OC)C(Cc1ccc(N)cc1)P(=O)(O)O |
| InChI | InChI=1S/C10H17NO6P2/c1-16-19(15,17-2)10(18(12,13)14)7-8-3-5-9(11)6-4-8/h3-6,10H,7,11H2,1-2H3,(H2,12,13,14) |
| InChIKey | PHTVBDGWHBONTK-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.20 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|