C18H28O14P4 — CID 167673236
[2-(3-methoxyphenyl)-1-phosphonoethyl]phosphonic acid (PubChem CID 167673236) has the molecular formula C18H28O14P4 and a molecular weight of 592.30 g/mol. Its IUPAC name is [2-(3-methoxyphenyl)-1-phosphonoethyl]phosphonic acid.
| Compound Name | [2-(3-methoxyphenyl)-1-phosphonoethyl]phosphonic acid |
|---|---|
| PubChem CID | 167673236 |
| Molecular Formula | C18H28O14P4 |
| Molecular Weight | 592.30 g/mol |
| Exact Mass | 592.04 |
| IUPAC Name | [2-(3-methoxyphenyl)-1-phosphonoethyl]phosphonic acid |
| SMILES | COc1cccc(CC(P(=O)(O)O)P(=O)(O)O)c1.COc1cccc(CC(P(=O)(O)O)P(=O)(O)O)c1 |
| InChI | InChI=1S/2C9H14O7P2/c2*1-16-8-4-2-3-7(5-8)6-9(17(10,11)12)18(13,14)15/h2*2-5,9H,6H2,1H3,(H2,10,11,12)(H2,13,14,15) |
| InChIKey | UKZGKHOBZZYOIN-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 248.58 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.30 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|