C8H12O8P2 — CID 151235649
(3-methoxyphenyl)methyl phosphono hydrogen phosphate (PubChem CID 151235649) has the molecular formula C8H12O8P2 and a molecular weight of 298.12 g/mol. Its IUPAC name is (3-methoxyphenyl)methyl phosphono hydrogen phosphate.
| Compound Name | (3-methoxyphenyl)methyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 151235649 |
| Molecular Formula | C8H12O8P2 |
| Molecular Weight | 298.12 g/mol |
| Exact Mass | 298.00 |
| IUPAC Name | (3-methoxyphenyl)methyl phosphono hydrogen phosphate |
| SMILES | COc1cccc(COP(=O)(O)OP(=O)(O)O)c1 |
| InChI | InChI=1S/C8H12O8P2/c1-14-8-4-2-3-7(5-8)6-15-18(12,13)16-17(9,10)11/h2-5H,6H2,1H3,(H,12,13)(H2,9,10,11) |
| InChIKey | NPFGCIUSSAYXRY-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.12 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|