C15H27NO5 — CID 87764067
6-(7,8,12,13-tetraoxaspiro[5.7]tridecan-10-yl)hexanamide (PubChem CID 87764067) has the molecular formula C15H27NO5 and a molecular weight of 301.38 g/mol. Its IUPAC name is 6-(7,8,12,13-tetraoxaspiro[5.7]tridecan-10-yl)hexanamide.
| Compound Name | 6-(7,8,12,13-tetraoxaspiro[5.7]tridecan-10-yl)hexanamide |
|---|---|
| PubChem CID | 87764067 |
| Molecular Formula | C15H27NO5 |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | 6-(7,8,12,13-tetraoxaspiro[5.7]tridecan-10-yl)hexanamide |
| SMILES | NC(=O)CCCCCC1COOC2(CCCCC2)OOC1 |
| InChI | InChI=1S/C15H27NO5/c16-14(17)8-4-1-3-7-13-11-18-20-15(21-19-12-13)9-5-2-6-10-15/h13H,1-12H2,(H2,16,17) |
| InChIKey | HCCYIDPJMNNCNM-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|