C10H17NO5 — CID 87395608
7,8,12,13-tetraoxaspiro[5.7]tridecane-10-carboxamide (PubChem CID 87395608) has the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. Its IUPAC name is 7,8,12,13-tetraoxaspiro[5.7]tridecane-10-carboxamide.
| Compound Name | 7,8,12,13-tetraoxaspiro[5.7]tridecane-10-carboxamide |
|---|---|
| PubChem CID | 87395608 |
| Molecular Formula | C10H17NO5 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 7,8,12,13-tetraoxaspiro[5.7]tridecane-10-carboxamide |
| SMILES | NC(=O)C1COOC2(CCCCC2)OOC1 |
| InChI | InChI=1S/C10H17NO5/c11-9(12)8-6-13-15-10(16-14-7-8)4-2-1-3-5-10/h8H,1-7H2,(H2,11,12) |
| InChIKey | RRDYSIPYYZOUNC-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|