C6H13N2O2+ — CID 167468374
1,4-oxazepan-4-ium-6-carboxamide (PubChem CID 167468374) has the molecular formula C6H13N2O2+ and a molecular weight of 145.18 g/mol. Its IUPAC name is 1,4-oxazepan-4-ium-6-carboxamide.
| Compound Name | 1,4-oxazepan-4-ium-6-carboxamide |
|---|---|
| PubChem CID | 167468374 |
| Molecular Formula | C6H13N2O2+ |
| Molecular Weight | 145.18 g/mol |
| Exact Mass | 145.10 |
| IUPAC Name | 1,4-oxazepan-4-ium-6-carboxamide |
| SMILES | NC(=O)C1C[NH2+]CCOC1 |
| InChI | InChI=1S/C6H12N2O2/c7-6(9)5-3-8-1-2-10-4-5/h5,8H,1-4H2,(H2,7,9)/p+1 |
| InChIKey | UFTBYQDZAWIOOM-UHFFFAOYSA-O |
| XLogP | -2.32 |
| TPSA | 68.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.18 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |