C25H29N3O3S — CID 87764682
N-(3-acetylphenyl)-3-[(3,5-dimethylphenyl)methyl]-2-oxo-1-oxa-3,4-diazaspiro[4.5]decane-4-carbothioamide (PubChem CID 87764682) has the molecular formula C25H29N3O3S and a molecular weight of 451.59 g/mol. Its IUPAC name is N-(3-acetylphenyl)-3-[(3,5-dimethylphenyl)methyl]-2-oxo-1-oxa-3,4-diazaspiro[4.5]decane-4-carbothioamide.
| Compound Name | N-(3-acetylphenyl)-3-[(3,5-dimethylphenyl)methyl]-2-oxo-1-oxa-3,4-diazaspiro[4.5]decane-4-carbothioamide |
|---|---|
| PubChem CID | 87764682 |
| Molecular Formula | C25H29N3O3S |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | N-(3-acetylphenyl)-3-[(3,5-dimethylphenyl)methyl]-2-oxo-1-oxa-3,4-diazaspiro[4.5]decane-4-carbothioamide |
| SMILES | CC(=O)c1cccc(NC(=S)N2N(Cc3cc(C)cc(C)c3)C(=O)OC23CCCCC3)c1 |
| InChI | InChI=1S/C25H29N3O3S/c1-17-12-18(2)14-20(13-17)16-27-24(30)31-25(10-5-4-6-11-25)28(27)23(32)26-22-9-7-8-21(15-22)19(3)29/h7-9,12-15H,4-6,10-11,16H2,1-3H3,(H,26,32) |
| InChIKey | ZOWOUDRKYDCKPH-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|