About bis(2-[bis(octylsulfanyl)amino]acetate);dioctyltin(2+)
bis(2-[bis(octylsulfanyl)amino]acetate);dioctyltin(2+) (PubChem CID 87769878) has the molecular formula C52H106N2O4S4Sn
and a molecular weight of 1070.41 g/mol. Its IUPAC name is bis(2-[bis(octylsulfanyl)amino]acetate);dioctyltin(2+).
Molecular Properties
| Compound Name | bis(2-[bis(octylsulfanyl)amino]acetate);dioctyltin(2+) |
| PubChem CID | 87769878 |
| Molecular Formula | C52H106N2O4S4Sn |
| Molecular Weight | 1070.41 g/mol |
| Exact Mass | 1070.61 |
| IUPAC Name | bis(2-[bis(octylsulfanyl)amino]acetate);dioctyltin(2+) |
| SMILES | CCCCCCCCSN(CC(=O)[O-])SCCCCCCCC.CCCCCCCCSN(CC(=O)[O-])SCCCCCCCC.CCCCCCCC[Sn+2]CCCCCCCC |
| InChI | InChI=1S/2C18H37NO2S2.2C8H17.Sn/c2*1-3-5-7-9-11-13-15-22-19(17-18(20)21)23-16-14-12-10-8-6-4-2;2*1-3-5-7-8-6-4-2;/h2*3-17H2,1-2H3,(H,20,21);2*1,3-8H2,2H3;/q;;;;+2/p-2 |
| InChIKey | SFJZUVZTWXEYCM-UHFFFAOYSA-L |
| XLogP | 16.36 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 50 |
| Heavy Atoms | 63 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1070.41 |
| LogP ≤ 5 | 16.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze bis(2-[bis(octylsulfanyl)amino]acetate);dioctyltin(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-[bis(octylsulfanyl)amino]acetate);dioctyltin(2+)?
The IUPAC name of bis(2-[bis(octylsulfanyl)amino]acetate);dioctyltin(2+) (CID 87769878) is bis(2-[bis(octylsulfanyl)amino]acetate);dioctyltin(2+).
What is the SMILES notation for bis(2-[bis(octylsulfanyl)amino]acetate);dioctyltin(2+)?
The canonical SMILES for bis(2-[bis(octylsulfanyl)amino]acetate);dioctyltin(2+) is CCCCCCCCSN(CC(=O)[O-])SCCCCCCCC.CCCCCCCCSN(CC(=O)[O-])SCCCCCCCC.CCCCCCCC[Sn+2]CCCCCCCC.
What is the InChIKey of bis(2-[bis(octylsulfanyl)amino]acetate);dioctyltin(2+)?
The InChIKey is SFJZUVZTWXEYCM-UHFFFAOYSA-L. The full InChI is InChI=1S/2C18H37NO2S2.2C8H17.Sn/c2*1-3-5-7-9-11-13-15-22-19(17-18(20)21)23-16-14-12-10-8-6-4-2;2*1-3-5-7-8-6-4-2;/h2*3-17H2,1-2H3,(H,20,21);2*1,3-8H2,2H3;/q;;;;+2/p-2.
What are the key properties of bis(2-[bis(octylsulfanyl)amino]acetate);dioctyltin(2+)?
bis(2-[bis(octylsulfanyl)amino]acetate);dioctyltin(2+) has a molecular weight of 1070.41 g/mol, XLogP of 16.36, 50 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-[bis(octylsulfanyl)amino]acetate);dioctyltin(2+) is sourced from PubChem (CID 87769878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).