C24H22N2O5S2 — CID 87772660
[3-[4-[[3-(3-methoxyphenyl)phenyl]methyl]-5-oxo-2-sulfanylideneimidazolidin-4-yl]phenyl] methanesulfonate (PubChem CID 87772660) has the molecular formula C24H22N2O5S2 and a molecular weight of 482.58 g/mol. Its IUPAC name is [3-[4-[[3-(3-methoxyphenyl)phenyl]methyl]-5-oxo-2-sulfanylideneimidazolidin-4-yl]phenyl] methanesulfonate.
| Compound Name | [3-[4-[[3-(3-methoxyphenyl)phenyl]methyl]-5-oxo-2-sulfanylideneimidazolidin-4-yl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 87772660 |
| Molecular Formula | C24H22N2O5S2 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.10 |
| IUPAC Name | [3-[4-[[3-(3-methoxyphenyl)phenyl]methyl]-5-oxo-2-sulfanylideneimidazolidin-4-yl]phenyl] methanesulfonate |
| SMILES | COc1cccc(-c2cccc(CC3(c4cccc(OS(C)(=O)=O)c4)NC(=S)NC3=O)c2)c1 |
| InChI | InChI=1S/C24H22N2O5S2/c1-30-20-10-4-8-18(13-20)17-7-3-6-16(12-17)15-24(22(27)25-23(32)26-24)19-9-5-11-21(14-19)31-33(2,28)29/h3-14H,15H2,1-2H3,(H2,25,26,27,32) |
| InChIKey | GGRDLJUBUGHEEE-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|