C23H21N3O5S2 — CID 59764024
[4-[4-[4-(3-methoxyphenyl)-2-pyridinyl]-1-methyl-5-oxo-2-sulfanylideneimidazolidin-4-yl]phenyl] methanesulfonate (PubChem CID 59764024) has the molecular formula C23H21N3O5S2 and a molecular weight of 483.57 g/mol. Its IUPAC name is [4-[4-[4-(3-methoxyphenyl)-2-pyridinyl]-1-methyl-5-oxo-2-sulfanylideneimidazolidin-4-yl]phenyl] methanesulfonate.
| Compound Name | [4-[4-[4-(3-methoxyphenyl)-2-pyridinyl]-1-methyl-5-oxo-2-sulfanylideneimidazolidin-4-yl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 59764024 |
| Molecular Formula | C23H21N3O5S2 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.09 |
| IUPAC Name | [4-[4-[4-(3-methoxyphenyl)-2-pyridinyl]-1-methyl-5-oxo-2-sulfanylideneimidazolidin-4-yl]phenyl] methanesulfonate |
| SMILES | COc1cccc(-c2ccnc(C3(c4ccc(OS(C)(=O)=O)cc4)NC(=S)N(C)C3=O)c2)c1 |
| InChI | InChI=1S/C23H21N3O5S2/c1-26-21(27)23(25-22(26)32,17-7-9-18(10-8-17)31-33(3,28)29)20-14-16(11-12-24-20)15-5-4-6-19(13-15)30-2/h4-14H,1-3H3,(H,25,32) |
| InChIKey | WAVZRBCWOZVNHD-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|