C19H18BrN3O3S2 — CID 59671736
[3-[8-(3-bromophenyl)-6-sulfanylidene-2,3,4,7-tetrahydroimidazo[1,5-a]pyrimidin-8-yl]phenyl] methanesulfonate (PubChem CID 59671736) has the molecular formula C19H18BrN3O3S2 and a molecular weight of 480.41 g/mol. Its IUPAC name is [3-[8-(3-bromophenyl)-6-sulfanylidene-2,3,4,7-tetrahydroimidazo[1,5-a]pyrimidin-8-yl]phenyl] methanesulfonate.
| Compound Name | [3-[8-(3-bromophenyl)-6-sulfanylidene-2,3,4,7-tetrahydroimidazo[1,5-a]pyrimidin-8-yl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 59671736 |
| Molecular Formula | C19H18BrN3O3S2 |
| Molecular Weight | 480.41 g/mol |
| Exact Mass | 479.00 |
| IUPAC Name | [3-[8-(3-bromophenyl)-6-sulfanylidene-2,3,4,7-tetrahydroimidazo[1,5-a]pyrimidin-8-yl]phenyl] methanesulfonate |
| SMILES | CS(=O)(=O)Oc1cccc(C2(c3cccc(Br)c3)NC(=S)N3CCCN=C32)c1 |
| InChI | InChI=1S/C19H18BrN3O3S2/c1-28(24,25)26-16-8-3-6-14(12-16)19(13-5-2-7-15(20)11-13)17-21-9-4-10-23(17)18(27)22-19/h2-3,5-8,11-12H,4,9-10H2,1H3,(H,22,27) |
| InChIKey | SMTKMDNJRULQKF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.41 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|