C18H13BrF3N3O2S — CID 89041297
8-(3-bromophenyl)-8-[4-(trifluoromethoxy)phenyl]-4,7-dihydro-3H-imidazo[5,1-c][1,2,4]oxadiazine-6-thione (PubChem CID 89041297) has the molecular formula C18H13BrF3N3O2S and a molecular weight of 472.29 g/mol. Its IUPAC name is 8-(3-bromophenyl)-8-[4-(trifluoromethoxy)phenyl]-4,7-dihydro-3H-imidazo[5,1-c][1,2,4]oxadiazine-6-thione.
| Compound Name | 8-(3-bromophenyl)-8-[4-(trifluoromethoxy)phenyl]-4,7-dihydro-3H-imidazo[5,1-c][1,2,4]oxadiazine-6-thione |
|---|---|
| PubChem CID | 89041297 |
| Molecular Formula | C18H13BrF3N3O2S |
| Molecular Weight | 472.29 g/mol |
| Exact Mass | 470.99 |
| IUPAC Name | 8-(3-bromophenyl)-8-[4-(trifluoromethoxy)phenyl]-4,7-dihydro-3H-imidazo[5,1-c][1,2,4]oxadiazine-6-thione |
| SMILES | FC(F)(F)Oc1ccc(C2(c3cccc(Br)c3)NC(=S)N3CCON=C32)cc1 |
| InChI | InChI=1S/C18H13BrF3N3O2S/c19-13-3-1-2-12(10-13)17(15-24-26-9-8-25(15)16(28)23-17)11-4-6-14(7-5-11)27-18(20,21)22/h1-7,10H,8-9H2,(H,23,28) |
| InChIKey | YTLKQHXONVOAFX-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.29 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|