C23H23BrF3N3O4S2 — CID 59394890
tert-butyl N-[2-[4-(3-bromophenyl)-2,5-bis(sulfanylidene)-4-[4-(trifluoromethoxy)phenyl]imidazolidin-1-yl]oxyethyl]carbamate (PubChem CID 59394890) has the molecular formula C23H23BrF3N3O4S2 and a molecular weight of 606.49 g/mol. Its IUPAC name is tert-butyl N-[2-[4-(3-bromophenyl)-2,5-bis(sulfanylidene)-4-[4-(trifluoromethoxy)phenyl]imidazolidin-1-yl]oxyethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-(3-bromophenyl)-2,5-bis(sulfanylidene)-4-[4-(trifluoromethoxy)phenyl]imidazolidin-1-yl]oxyethyl]carbamate |
|---|---|
| PubChem CID | 59394890 |
| Molecular Formula | C23H23BrF3N3O4S2 |
| Molecular Weight | 606.49 g/mol |
| Exact Mass | 605.03 |
| IUPAC Name | tert-butyl N-[2-[4-(3-bromophenyl)-2,5-bis(sulfanylidene)-4-[4-(trifluoromethoxy)phenyl]imidazolidin-1-yl]oxyethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCON1C(=S)NC(c2ccc(OC(F)(F)F)cc2)(c2cccc(Br)c2)C1=S |
| InChI | InChI=1S/C23H23BrF3N3O4S2/c1-21(2,3)34-20(31)28-11-12-32-30-18(35)22(29-19(30)36,15-5-4-6-16(24)13-15)14-7-9-17(10-8-14)33-23(25,26)27/h4-10,13H,11-12H2,1-3H3,(H,28,31)(H,29,36) |
| InChIKey | IOWZCPBIBSSYSQ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.49 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|