C26H35F3N4O2S — CID 143261477
ethane;N-[3-[5-imino-1-propyl-2-sulfanylidene-4-[4-(trifluoromethoxy)phenyl]imidazolidin-4-yl]phenyl]propanamide (PubChem CID 143261477) has the molecular formula C26H35F3N4O2S and a molecular weight of 524.65 g/mol. Its IUPAC name is ethane;N-[3-[5-imino-1-propyl-2-sulfanylidene-4-[4-(trifluoromethoxy)phenyl]imidazolidin-4-yl]phenyl]propanamide.
| Compound Name | ethane;N-[3-[5-imino-1-propyl-2-sulfanylidene-4-[4-(trifluoromethoxy)phenyl]imidazolidin-4-yl]phenyl]propanamide |
|---|---|
| PubChem CID | 143261477 |
| Molecular Formula | C26H35F3N4O2S |
| Molecular Weight | 524.65 g/mol |
| Exact Mass | 524.24 |
| IUPAC Name | ethane;N-[3-[5-imino-1-propyl-2-sulfanylidene-4-[4-(trifluoromethoxy)phenyl]imidazolidin-4-yl]phenyl]propanamide |
| SMILES | CC.CC.[H]/N=C1\N(CCC)C(=S)NC1(c1ccc(OC(F)(F)F)cc1)c1cccc(NC(=O)CC)c1 |
| InChI | InChI=1S/C22H23F3N4O2S.2C2H6/c1-3-12-29-19(26)21(28-20(29)32,14-8-10-17(11-9-14)31-22(23,24)25)15-6-5-7-16(13-15)27-18(30)4-2;2*1-2/h5-11,13,26H,3-4,12H2,1-2H3,(H,27,30)(H,28,32);2*1-2H3/b26-19-;; |
| InChIKey | PKTVZORARMGDBT-WKPMAHTOSA-N |
| XLogP | 6.81 |
| TPSA | 77.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.65 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|