C18H11F6NO4 — CID 87200282
(5R)-5-[3-(trifluoromethoxy)phenyl]-5-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,3-dione (PubChem CID 87200282) has the molecular formula C18H11F6NO4 and a molecular weight of 419.28 g/mol. Its IUPAC name is (5R)-5-[3-(trifluoromethoxy)phenyl]-5-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,3-dione.
| Compound Name | (5R)-5-[3-(trifluoromethoxy)phenyl]-5-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 87200282 |
| Molecular Formula | C18H11F6NO4 |
| Molecular Weight | 419.28 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | (5R)-5-[3-(trifluoromethoxy)phenyl]-5-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,3-dione |
| SMILES | O=C1C[C@@](c2ccc(OC(F)(F)F)cc2)(c2cccc(OC(F)(F)F)c2)NC1=O |
| InChI | InChI=1S/C18H11F6NO4/c19-17(20,21)28-12-6-4-10(5-7-12)16(9-14(26)15(27)25-16)11-2-1-3-13(8-11)29-18(22,23)24/h1-8H,9H2,(H,25,27)/t16-/m1/s1 |
| InChIKey | GVIVNJFLUQFBMB-MRXNPFEDSA-N |
| XLogP | 3.82 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.28 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|