C22H21N3O6S — CID 87784122
[2-[2-amino-4-(furan-3-yl)-1-methyl-5-oxoimidazol-4-yl]-5-methoxy-3-phenylphenyl] methanesulfonate (PubChem CID 87784122) has the molecular formula C22H21N3O6S and a molecular weight of 455.49 g/mol. Its IUPAC name is [2-[2-amino-4-(furan-3-yl)-1-methyl-5-oxoimidazol-4-yl]-5-methoxy-3-phenylphenyl] methanesulfonate.
| Compound Name | [2-[2-amino-4-(furan-3-yl)-1-methyl-5-oxoimidazol-4-yl]-5-methoxy-3-phenylphenyl] methanesulfonate |
|---|---|
| PubChem CID | 87784122 |
| Molecular Formula | C22H21N3O6S |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | [2-[2-amino-4-(furan-3-yl)-1-methyl-5-oxoimidazol-4-yl]-5-methoxy-3-phenylphenyl] methanesulfonate |
| SMILES | COc1cc(OS(C)(=O)=O)c(C2(c3ccoc3)N=C(N)N(C)C2=O)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C22H21N3O6S/c1-25-20(26)22(24-21(25)23,15-9-10-30-13-15)19-17(14-7-5-4-6-8-14)11-16(29-2)12-18(19)31-32(3,27)28/h4-13H,1-3H3,(H2,23,24) |
| InChIKey | NJFBYZPKYPLMKO-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 124.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|