C24H23ClFN3O5S — CID 87728020
[3-[2-amino-4-[1-chloro-4-fluoro-5-(3-methoxyphenyl)cyclohexa-2,4-dien-1-yl]-1-methyl-5-oxoimidazol-4-yl]phenyl] methanesulfonate (PubChem CID 87728020) has the molecular formula C24H23ClFN3O5S and a molecular weight of 519.98 g/mol. Its IUPAC name is [3-[2-amino-4-[1-chloro-4-fluoro-5-(3-methoxyphenyl)cyclohexa-2,4-dien-1-yl]-1-methyl-5-oxoimidazol-4-yl]phenyl] methanesulfonate.
| Compound Name | [3-[2-amino-4-[1-chloro-4-fluoro-5-(3-methoxyphenyl)cyclohexa-2,4-dien-1-yl]-1-methyl-5-oxoimidazol-4-yl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 87728020 |
| Molecular Formula | C24H23ClFN3O5S |
| Molecular Weight | 519.98 g/mol |
| Exact Mass | 519.10 |
| IUPAC Name | [3-[2-amino-4-[1-chloro-4-fluoro-5-(3-methoxyphenyl)cyclohexa-2,4-dien-1-yl]-1-methyl-5-oxoimidazol-4-yl]phenyl] methanesulfonate |
| SMILES | COc1cccc(C2=C(F)C=CC(Cl)(C3(c4cccc(OS(C)(=O)=O)c4)N=C(N)N(C)C3=O)C2)c1 |
| InChI | InChI=1S/C24H23ClFN3O5S/c1-29-21(30)24(28-22(29)27,16-7-5-9-18(13-16)34-35(3,31)32)23(25)11-10-20(26)19(14-23)15-6-4-8-17(12-15)33-2/h4-13H,14H2,1-3H3,(H2,27,28) |
| InChIKey | GUXWBCQXVQGYDZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.98 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|