C19H19NO2 — CID 87782327
1-[3-[(1E)-1-hydroxyimino-3,3-dimethyl-2H-inden-5-yl]phenyl]ethanone (PubChem CID 87782327) has the molecular formula C19H19NO2 and a molecular weight of 293.37 g/mol. Its IUPAC name is 1-[3-[(1E)-1-hydroxyimino-3,3-dimethyl-2H-inden-5-yl]phenyl]ethanone.
| Compound Name | 1-[3-[(1E)-1-hydroxyimino-3,3-dimethyl-2H-inden-5-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 87782327 |
| Molecular Formula | C19H19NO2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 1-[3-[(1E)-1-hydroxyimino-3,3-dimethyl-2H-inden-5-yl]phenyl]ethanone |
| SMILES | CC(=O)c1cccc(-c2ccc3c(c2)C(C)(C)C/C3=N\O)c1 |
| InChI | InChI=1S/C19H19NO2/c1-12(21)13-5-4-6-14(9-13)15-7-8-16-17(10-15)19(2,3)11-18(16)20-22/h4-10,22H,11H2,1-3H3/b20-18+ |
| InChIKey | MHSMFZBGUBGAEJ-CZIZESTLSA-N |
| XLogP | 4.42 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|