C12H22ClNO5S — CID 87782762
(2S)-2-[(2-chloroacetyl)amino]-3-heptan-4-ylsulfonylpropanoic acid (PubChem CID 87782762) has the molecular formula C12H22ClNO5S and a molecular weight of 327.83 g/mol. Its IUPAC name is (2S)-2-[(2-chloroacetyl)amino]-3-heptan-4-ylsulfonylpropanoic acid.
| Compound Name | (2S)-2-[(2-chloroacetyl)amino]-3-heptan-4-ylsulfonylpropanoic acid |
|---|---|
| PubChem CID | 87782762 |
| Molecular Formula | C12H22ClNO5S |
| Molecular Weight | 327.83 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | (2S)-2-[(2-chloroacetyl)amino]-3-heptan-4-ylsulfonylpropanoic acid |
| SMILES | CCCC(CCC)S(=O)(=O)C[C@@H](NC(=O)CCl)C(=O)O |
| InChI | InChI=1S/C12H22ClNO5S/c1-3-5-9(6-4-2)20(18,19)8-10(12(16)17)14-11(15)7-13/h9-10H,3-8H2,1-2H3,(H,14,15)(H,16,17)/t10-/m1/s1 |
| InChIKey | LIFZIIHGPTZMSH-SNVBAGLBSA-N |
| XLogP | 1.18 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.83 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|