C17H31N3O4S — CID 142191618
(Z)-N-[(2S)-1-(dimethylamino)-3-heptan-4-ylsulfonyl-1-oxopropan-2-yl]-5-iminopent-3-enamide (PubChem CID 142191618) has the molecular formula C17H31N3O4S and a molecular weight of 373.52 g/mol. Its IUPAC name is (Z)-N-[(2S)-1-(dimethylamino)-3-heptan-4-ylsulfonyl-1-oxopropan-2-yl]-5-iminopent-3-enamide.
| Compound Name | (Z)-N-[(2S)-1-(dimethylamino)-3-heptan-4-ylsulfonyl-1-oxopropan-2-yl]-5-iminopent-3-enamide |
|---|---|
| PubChem CID | 142191618 |
| Molecular Formula | C17H31N3O4S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | (Z)-N-[(2S)-1-(dimethylamino)-3-heptan-4-ylsulfonyl-1-oxopropan-2-yl]-5-iminopent-3-enamide |
| SMILES | [H]/N=C/C=C\CC(=O)N[C@H](CS(=O)(=O)C(CCC)CCC)C(=O)N(C)C |
| InChI | InChI=1S/C17H31N3O4S/c1-5-9-14(10-6-2)25(23,24)13-15(17(22)20(3)4)19-16(21)11-7-8-12-18/h7-8,12,14-15,18H,5-6,9-11,13H2,1-4H3,(H,19,21)/b8-7-,18-12+/t15-/m1/s1 |
| InChIKey | JFFIZPSNUJLGKR-QOIDSDCPSA-N |
| XLogP | 1.54 |
| TPSA | 107.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|