C14H26O4Si — CID 87789572
(E)-2-[tri(propan-2-yl)silylmethyl]but-2-enedioic acid (PubChem CID 87789572) has the molecular formula C14H26O4Si and a molecular weight of 286.44 g/mol. Its IUPAC name is (E)-2-[tri(propan-2-yl)silylmethyl]but-2-enedioic acid.
| Compound Name | (E)-2-[tri(propan-2-yl)silylmethyl]but-2-enedioic acid |
|---|---|
| PubChem CID | 87789572 |
| Molecular Formula | C14H26O4Si |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | (E)-2-[tri(propan-2-yl)silylmethyl]but-2-enedioic acid |
| SMILES | CC(C)[Si](C/C(=C/C(=O)O)C(=O)O)(C(C)C)C(C)C |
| InChI | InChI=1S/C14H26O4Si/c1-9(2)19(10(3)4,11(5)6)8-12(14(17)18)7-13(15)16/h7,9-11H,8H2,1-6H3,(H,15,16)(H,17,18)/b12-7- |
| InChIKey | HHJXFICKEUXQSK-GHXNOFRVSA-N |
| XLogP | 3.76 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|