C17H34NO8P — CID 87789705
[(2S)-1,2-dihydroxy-4,12-dioxododecan-3-yl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 87789705) has the molecular formula C17H34NO8P and a molecular weight of 411.43 g/mol. Its IUPAC name is [(2S)-1,2-dihydroxy-4,12-dioxododecan-3-yl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2S)-1,2-dihydroxy-4,12-dioxododecan-3-yl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 87789705 |
| Molecular Formula | C17H34NO8P |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | [(2S)-1,2-dihydroxy-4,12-dioxododecan-3-yl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | C[N+](C)(C)CCOP(=O)([O-])OC(C(=O)CCCCCCCC=O)[C@@H](O)CO |
| InChI | InChI=1S/C17H34NO8P/c1-18(2,3)11-13-25-27(23,24)26-17(16(22)14-20)15(21)10-8-6-4-5-7-9-12-19/h12,16-17,20,22H,4-11,13-14H2,1-3H3/t16-,17?/m0/s1 |
| InChIKey | FDZDKVWWLGOYBA-BHWOMJMDSA-N |
| XLogP | 0.41 |
| TPSA | 133.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|