C30H50NO7P — CID 71777232
[(2S,5E,7E,9E,11E,13E,15E)-1,2-dihydroxy-4-oxopentacosa-5,7,9,11,13,15-hexaen-3-yl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 71777232) has the molecular formula C30H50NO7P and a molecular weight of 567.70 g/mol. Its IUPAC name is [(2S,5E,7E,9E,11E,13E,15E)-1,2-dihydroxy-4-oxopentacosa-5,7,9,11,13,15-hexaen-3-yl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2S,5E,7E,9E,11E,13E,15E)-1,2-dihydroxy-4-oxopentacosa-5,7,9,11,13,15-hexaen-3-yl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 71777232 |
| Molecular Formula | C30H50NO7P |
| Molecular Weight | 567.70 g/mol |
| Exact Mass | 567.33 |
| IUPAC Name | [(2S,5E,7E,9E,11E,13E,15E)-1,2-dihydroxy-4-oxopentacosa-5,7,9,11,13,15-hexaen-3-yl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCCCCCC/C=C/C=C/C=C/C=C/C=C/C=C/C(=O)C(OP(=O)([O-])OCC[N+](C)(C)C)[C@@H](O)CO |
| InChI | InChI=1S/C30H50NO7P/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-28(33)30(29(34)27-32)38-39(35,36)37-26-25-31(2,3)4/h13-24,29-30,32,34H,5-12,25-27H2,1-4H3/b14-13+,16-15+,18-17+,20-19+,22-21+,24-23+/t29-,30?/m0/s1 |
| InChIKey | LZFSTOPIZVUBCU-OOVUWCTJSA-N |
| XLogP | 4.96 |
| TPSA | 116.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.70 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|