About acetyl 2-(dibutylamino)acetate
acetyl 2-(dibutylamino)acetate (PubChem CID 87791730) has the molecular formula C12H23NO3
and a molecular weight of 229.32 g/mol. Its IUPAC name is acetyl 2-(dibutylamino)acetate.
Molecular Properties
| Compound Name | acetyl 2-(dibutylamino)acetate |
| PubChem CID | 87791730 |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | acetyl 2-(dibutylamino)acetate |
| SMILES | CCCCN(CCCC)CC(=O)OC(C)=O |
| InChI | InChI=1S/C12H23NO3/c1-4-6-8-13(9-7-5-2)10-12(15)16-11(3)14/h4-10H2,1-3H3 |
| InChIKey | KIKXNRCWWYZIHP-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze acetyl 2-(dibutylamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyl 2-(dibutylamino)acetate?
The IUPAC name of acetyl 2-(dibutylamino)acetate (CID 87791730) is acetyl 2-(dibutylamino)acetate.
What is the SMILES notation for acetyl 2-(dibutylamino)acetate?
The canonical SMILES for acetyl 2-(dibutylamino)acetate is CCCCN(CCCC)CC(=O)OC(C)=O.
What is the InChIKey of acetyl 2-(dibutylamino)acetate?
The InChIKey is KIKXNRCWWYZIHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO3/c1-4-6-8-13(9-7-5-2)10-12(15)16-11(3)14/h4-10H2,1-3H3.
What are the key properties of acetyl 2-(dibutylamino)acetate?
acetyl 2-(dibutylamino)acetate has a molecular weight of 229.32 g/mol, XLogP of 1.98, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetyl 2-(dibutylamino)acetate is sourced from PubChem (CID 87791730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).