About 3-cyclohexyl-6-phenylmethoxy-1,2-benzothiazole;sulfuryl dichloride
3-cyclohexyl-6-phenylmethoxy-1,2-benzothiazole;sulfuryl dichloride (PubChem CID 87793944) has the molecular formula C20H21Cl2NO3S2
and a molecular weight of 458.43 g/mol. Its IUPAC name is 3-cyclohexyl-6-phenylmethoxy-1,2-benzothiazole;sulfuryl dichloride.
Molecular Properties
| Compound Name | 3-cyclohexyl-6-phenylmethoxy-1,2-benzothiazole;sulfuryl dichloride |
| PubChem CID | 87793944 |
| Molecular Formula | C20H21Cl2NO3S2 |
| Molecular Weight | 458.43 g/mol |
| Exact Mass | 457.03 |
| IUPAC Name | 3-cyclohexyl-6-phenylmethoxy-1,2-benzothiazole;sulfuryl dichloride |
| SMILES | O=S(=O)(Cl)Cl.c1ccc(COc2ccc3c(C4CCCCC4)nsc3c2)cc1 |
| InChI | InChI=1S/C20H21NOS.Cl2O2S/c1-3-7-15(8-4-1)14-22-17-11-12-18-19(13-17)23-21-20(18)16-9-5-2-6-10-16;1-5(2,3)4/h1,3-4,7-8,11-13,16H,2,5-6,9-10,14H2; |
| InChIKey | HTVYLZMRPOYIFR-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.43 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-cyclohexyl-6-phenylmethoxy-1,2-benzothiazole;sulfuryl dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexyl-6-phenylmethoxy-1,2-benzothiazole;sulfuryl dichloride?
The IUPAC name of 3-cyclohexyl-6-phenylmethoxy-1,2-benzothiazole;sulfuryl dichloride (CID 87793944) is 3-cyclohexyl-6-phenylmethoxy-1,2-benzothiazole;sulfuryl dichloride.
What is the SMILES notation for 3-cyclohexyl-6-phenylmethoxy-1,2-benzothiazole;sulfuryl dichloride?
The canonical SMILES for 3-cyclohexyl-6-phenylmethoxy-1,2-benzothiazole;sulfuryl dichloride is O=S(=O)(Cl)Cl.c1ccc(COc2ccc3c(C4CCCCC4)nsc3c2)cc1.
What is the InChIKey of 3-cyclohexyl-6-phenylmethoxy-1,2-benzothiazole;sulfuryl dichloride?
The InChIKey is HTVYLZMRPOYIFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21NOS.Cl2O2S/c1-3-7-15(8-4-1)14-22-17-11-12-18-19(13-17)23-21-20(18)16-9-5-2-6-10-16;1-5(2,3)4/h1,3-4,7-8,11-13,16H,2,5-6,9-10,14H2;.
What are the key properties of 3-cyclohexyl-6-phenylmethoxy-1,2-benzothiazole;sulfuryl dichloride?
3-cyclohexyl-6-phenylmethoxy-1,2-benzothiazole;sulfuryl dichloride has a molecular weight of 458.43 g/mol, XLogP of 6.63, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexyl-6-phenylmethoxy-1,2-benzothiazole;sulfuryl dichloride is sourced from PubChem (CID 87793944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).