C25H30N2O3 — CID 86626347
butyl 3-cyclohexyl-6-phenylmethoxyindazole-1-carboxylate (PubChem CID 86626347) has the molecular formula C25H30N2O3 and a molecular weight of 406.53 g/mol. Its IUPAC name is butyl 3-cyclohexyl-6-phenylmethoxyindazole-1-carboxylate.
| Compound Name | butyl 3-cyclohexyl-6-phenylmethoxyindazole-1-carboxylate |
|---|---|
| PubChem CID | 86626347 |
| Molecular Formula | C25H30N2O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | butyl 3-cyclohexyl-6-phenylmethoxyindazole-1-carboxylate |
| SMILES | CCCCOC(=O)n1nc(C2CCCCC2)c2ccc(OCc3ccccc3)cc21 |
| InChI | InChI=1S/C25H30N2O3/c1-2-3-16-29-25(28)27-23-17-21(30-18-19-10-6-4-7-11-19)14-15-22(23)24(26-27)20-12-8-5-9-13-20/h4,6-7,10-11,14-15,17,20H,2-3,5,8-9,12-13,16,18H2,1H3 |
| InChIKey | ZFVJCWIWYCWMDH-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|