C27H19F8N5O4 — CID 87800360
N-[difluoro-(2,3,4-trifluorophenyl)methoxy]-5-(phenylmethoxymethyl)-1-[4-(2,2,2-trifluoroethylcarbamoyl)phenyl]triazole-4-carboxamide (PubChem CID 87800360) has the molecular formula C27H19F8N5O4 and a molecular weight of 629.46 g/mol. Its IUPAC name is N-[difluoro-(2,3,4-trifluorophenyl)methoxy]-5-(phenylmethoxymethyl)-1-[4-(2,2,2-trifluoroethylcarbamoyl)phenyl]triazole-4-carboxamide.
| Compound Name | N-[difluoro-(2,3,4-trifluorophenyl)methoxy]-5-(phenylmethoxymethyl)-1-[4-(2,2,2-trifluoroethylcarbamoyl)phenyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 87800360 |
| Molecular Formula | C27H19F8N5O4 |
| Molecular Weight | 629.46 g/mol |
| Exact Mass | 629.13 |
| IUPAC Name | N-[difluoro-(2,3,4-trifluorophenyl)methoxy]-5-(phenylmethoxymethyl)-1-[4-(2,2,2-trifluoroethylcarbamoyl)phenyl]triazole-4-carboxamide |
| SMILES | O=C(NCC(F)(F)F)c1ccc(-n2nnc(C(=O)NOC(F)(F)c3ccc(F)c(F)c3F)c2COCc2ccccc2)cc1 |
| InChI | InChI=1S/C27H19F8N5O4/c28-19-11-10-18(21(29)22(19)30)27(34,35)44-38-25(42)23-20(13-43-12-15-4-2-1-3-5-15)40(39-37-23)17-8-6-16(7-9-17)24(41)36-14-26(31,32)33/h1-11H,12-14H2,(H,36,41)(H,38,42) |
| InChIKey | CULQWRLGLAYMTH-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.46 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|