C23H22FN3O2S — CID 87800946
3-(1,3-benzothiazol-2-yl)-7-[4-(3-fluoropropyl)piperazin-1-yl]chromen-2-one (PubChem CID 87800946) has the molecular formula C23H22FN3O2S and a molecular weight of 423.51 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-7-[4-(3-fluoropropyl)piperazin-1-yl]chromen-2-one.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-7-[4-(3-fluoropropyl)piperazin-1-yl]chromen-2-one |
|---|---|
| PubChem CID | 87800946 |
| Molecular Formula | C23H22FN3O2S |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-7-[4-(3-fluoropropyl)piperazin-1-yl]chromen-2-one |
| SMILES | O=c1oc2cc(N3CCN(CCCF)CC3)ccc2cc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C23H22FN3O2S/c24-8-3-9-26-10-12-27(13-11-26)17-7-6-16-14-18(23(28)29-20(16)15-17)22-25-19-4-1-2-5-21(19)30-22/h1-2,4-7,14-15H,3,8-13H2 |
| InChIKey | WWWWGOYTZLTFNM-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 49.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|